C14H19N3O2 — CID 79961440
4-amino-5-[2-(4-methoxyphenyl)ethyl]-1,5-dimethylimidazol-2-one (PubChem CID 79961440) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-amino-5-[2-(4-methoxyphenyl)ethyl]-1,5-dimethylimidazol-2-one.
| Compound Name | 4-amino-5-[2-(4-methoxyphenyl)ethyl]-1,5-dimethylimidazol-2-one |
|---|---|
| PubChem CID | 79961440 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-amino-5-[2-(4-methoxyphenyl)ethyl]-1,5-dimethylimidazol-2-one |
| SMILES | COc1ccc(CCC2(C)C(N)=NC(=O)N2C)cc1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(12(15)16-13(18)17(14)2)9-8-10-4-6-11(19-3)7-5-10/h4-7H,8-9H2,1-3H3,(H2,15,16,18) |
| InChIKey | FBMPLLURPFXSLE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |