C13H15BrN2O3S2 — CID 79962051
5-amino-N-[(5-bromothiophen-2-yl)methyl]-2-methoxy-4-methylbenzenesulfonamide (PubChem CID 79962051) has the molecular formula C13H15BrN2O3S2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 5-amino-N-[(5-bromothiophen-2-yl)methyl]-2-methoxy-4-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-[(5-bromothiophen-2-yl)methyl]-2-methoxy-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79962051 |
| Molecular Formula | C13H15BrN2O3S2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 5-amino-N-[(5-bromothiophen-2-yl)methyl]-2-methoxy-4-methylbenzenesulfonamide |
| SMILES | COc1cc(C)c(N)cc1S(=O)(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H15BrN2O3S2/c1-8-5-11(19-2)12(6-10(8)15)21(17,18)16-7-9-3-4-13(14)20-9/h3-6,16H,7,15H2,1-2H3 |
| InChIKey | RDNDVQAXRLQSIN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|