C11H20F3NS2 — CID 79966425
1-(1,4-dithian-2-yl)-4,4,4-trifluoro-N-propylbutan-1-amine (PubChem CID 79966425) has the molecular formula C11H20F3NS2 and a molecular weight of 287.42 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-4,4,4-trifluoro-N-propylbutan-1-amine.
| Compound Name | 1-(1,4-dithian-2-yl)-4,4,4-trifluoro-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79966425 |
| Molecular Formula | C11H20F3NS2 |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-4,4,4-trifluoro-N-propylbutan-1-amine |
| SMILES | CCCNC(CCC(F)(F)F)C1CSCCS1 |
| InChI | InChI=1S/C11H20F3NS2/c1-2-5-15-9(3-4-11(12,13)14)10-8-16-6-7-17-10/h9-10,15H,2-8H2,1H3 |
| InChIKey | JHTJHLHGOMETOZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |