C7H8F3N3O3 — CID 7996849
N'-[(Z)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]oxamide (PubChem CID 7996849) has the molecular formula C7H8F3N3O3 and a molecular weight of 239.15 g/mol. Its IUPAC name is N'-[(Z)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]oxamide.
| Compound Name | N'-[(Z)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]oxamide |
|---|---|
| PubChem CID | 7996849 |
| Molecular Formula | C7H8F3N3O3 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | N'-[(Z)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]oxamide |
| SMILES | C/C(CC(=O)C(F)(F)F)=N/NC(=O)C(N)=O |
| InChI | InChI=1S/C7H8F3N3O3/c1-3(2-4(14)7(8,9)10)12-13-6(16)5(11)15/h2H2,1H3,(H2,11,15)(H,13,16)/b12-3- |
| InChIKey | BINUKHXTXFBXLD-BASWHVEKSA-N |
| XLogP | -0.51 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|