C8H8F3N3O2 — CID 4269016
2-cyano-N-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide (PubChem CID 4269016) has the molecular formula C8H8F3N3O2 and a molecular weight of 235.16 g/mol. Its IUPAC name is 2-cyano-N-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide.
| Compound Name | 2-cyano-N-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 4269016 |
| Molecular Formula | C8H8F3N3O2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-cyano-N-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide |
| SMILES | CC(CC(=O)C(F)(F)F)=NNC(=O)CC#N |
| InChI | InChI=1S/C8H8F3N3O2/c1-5(4-6(15)8(9,10)11)13-14-7(16)2-3-12/h2,4H2,1H3,(H,14,16) |
| InChIKey | SDGRECJRTKVUOW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|