C15H16BrFS — CID 79976512
2-[bromo-(4-fluoro-3,5-dimethylphenyl)methyl]-3-ethylthiophene (PubChem CID 79976512) has the molecular formula C15H16BrFS and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-[bromo-(4-fluoro-3,5-dimethylphenyl)methyl]-3-ethylthiophene.
| Compound Name | 2-[bromo-(4-fluoro-3,5-dimethylphenyl)methyl]-3-ethylthiophene |
|---|---|
| PubChem CID | 79976512 |
| Molecular Formula | C15H16BrFS |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2-[bromo-(4-fluoro-3,5-dimethylphenyl)methyl]-3-ethylthiophene |
| SMILES | CCc1ccsc1C(Br)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C15H16BrFS/c1-4-11-5-6-18-15(11)13(16)12-7-9(2)14(17)10(3)8-12/h5-8,13H,4H2,1-3H3 |
| InChIKey | WRYKLKOCHAWZBJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|