C11H9Br3S2 — CID 80534116
2,3-dibromo-5-[bromo-(3-ethylthiophen-2-yl)methyl]thiophene (PubChem CID 80534116) has the molecular formula C11H9Br3S2 and a molecular weight of 445.04 g/mol. Its IUPAC name is 2,3-dibromo-5-[bromo-(3-ethylthiophen-2-yl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[bromo-(3-ethylthiophen-2-yl)methyl]thiophene |
|---|---|
| PubChem CID | 80534116 |
| Molecular Formula | C11H9Br3S2 |
| Molecular Weight | 445.04 g/mol |
| Exact Mass | 441.77 |
| IUPAC Name | 2,3-dibromo-5-[bromo-(3-ethylthiophen-2-yl)methyl]thiophene |
| SMILES | CCc1ccsc1C(Br)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H9Br3S2/c1-2-6-3-4-15-10(6)9(13)8-5-7(12)11(14)16-8/h3-5,9H,2H2,1H3 |
| InChIKey | OXANJINJFPGAPS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.04 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|