C13H17NO4S — CID 799893
(4-hydroxy-3,5-dimethoxyphenyl)-morpholin-4-ylmethanethione (PubChem CID 799893) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethoxyphenyl)-morpholin-4-ylmethanethione.
| Compound Name | (4-hydroxy-3,5-dimethoxyphenyl)-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 799893 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (4-hydroxy-3,5-dimethoxyphenyl)-morpholin-4-ylmethanethione |
| SMILES | COc1cc(C(=S)N2CCOCC2)cc(OC)c1O |
| InChI | InChI=1S/C13H17NO4S/c1-16-10-7-9(8-11(17-2)12(10)15)13(19)14-3-5-18-6-4-14/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | ALPABHREUMPPOX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|