C14H16N4OS — CID 79994606
2-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]-1,3-benzoxazol-4-amine (PubChem CID 79994606) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]-1,3-benzoxazol-4-amine.
| Compound Name | 2-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 79994606 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]-1,3-benzoxazol-4-amine |
| SMILES | Cc1ncsc1CN(C)Cc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C14H16N4OS/c1-9-12(20-8-16-9)6-18(2)7-13-17-14-10(15)4-3-5-11(14)19-13/h3-5,8H,6-7,15H2,1-2H3 |
| InChIKey | DGMHOGQSQAAXFZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|