C20H34O — CID 79995433
2-cyclohexyl-1-(3,5-dimethyl-1-adamantyl)ethanol (PubChem CID 79995433) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,5-dimethyl-1-adamantyl)ethanol.
| Compound Name | 2-cyclohexyl-1-(3,5-dimethyl-1-adamantyl)ethanol |
|---|---|
| PubChem CID | 79995433 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 2-cyclohexyl-1-(3,5-dimethyl-1-adamantyl)ethanol |
| SMILES | CC12CC3CC(C)(C1)CC(C(O)CC1CCCCC1)(C3)C2 |
| InChI | InChI=1S/C20H34O/c1-18-9-16-10-19(2,12-18)14-20(11-16,13-18)17(21)8-15-6-4-3-5-7-15/h15-17,21H,3-14H2,1-2H3 |
| InChIKey | VGCDXBKXVJHOBS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |