C14H18N4O2 — CID 79996157
3-[(6-amino-1,3-benzoxazol-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile (PubChem CID 79996157) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzoxazol-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[(6-amino-1,3-benzoxazol-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 79996157 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-[(6-amino-1,3-benzoxazol-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)Cc1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C14H18N4O2/c1-19-8-7-18(6-2-5-15)10-14-17-12-4-3-11(16)9-13(12)20-14/h3-4,9H,2,6-8,10,16H2,1H3 |
| InChIKey | JTAVTGUCKUMVFW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|