C14H15BrClNO2S2 — CID 79999013
5-bromo-N-[(3-chlorophenyl)methyl]-N-ethyl-4-methylthiophene-2-sulfonamide (PubChem CID 79999013) has the molecular formula C14H15BrClNO2S2 and a molecular weight of 408.77 g/mol. Its IUPAC name is 5-bromo-N-[(3-chlorophenyl)methyl]-N-ethyl-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(3-chlorophenyl)methyl]-N-ethyl-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79999013 |
| Molecular Formula | C14H15BrClNO2S2 |
| Molecular Weight | 408.77 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | 5-bromo-N-[(3-chlorophenyl)methyl]-N-ethyl-4-methylthiophene-2-sulfonamide |
| SMILES | CCN(Cc1cccc(Cl)c1)S(=O)(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C14H15BrClNO2S2/c1-3-17(9-11-5-4-6-12(16)8-11)21(18,19)13-7-10(2)14(15)20-13/h4-8H,3,9H2,1-2H3 |
| InChIKey | IUTKOKAMQMILQJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |