C13H14BrClN2O2S2 — CID 80576976
N-[(2-aminophenyl)methyl]-5-bromo-4-chloro-N-ethylthiophene-2-sulfonamide (PubChem CID 80576976) has the molecular formula C13H14BrClN2O2S2 and a molecular weight of 409.76 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-5-bromo-4-chloro-N-ethylthiophene-2-sulfonamide.
| Compound Name | N-[(2-aminophenyl)methyl]-5-bromo-4-chloro-N-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80576976 |
| Molecular Formula | C13H14BrClN2O2S2 |
| Molecular Weight | 409.76 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-5-bromo-4-chloro-N-ethylthiophene-2-sulfonamide |
| SMILES | CCN(Cc1ccccc1N)S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C13H14BrClN2O2S2/c1-2-17(8-9-5-3-4-6-11(9)16)21(18,19)12-7-10(15)13(14)20-12/h3-7H,2,8,16H2,1H3 |
| InChIKey | YJUSCQKWXBFALT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|