About 8-azidoquinoline
8-azidoquinoline (PubChem CID 11321201) has the molecular formula C9H6N4
and a molecular weight of 170.18 g/mol. Its IUPAC name is 8-azidoquinoline.
Molecular Properties
| Compound Name | 8-azidoquinoline |
| PubChem CID | 11321201 |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 8-azidoquinoline |
| SMILES | [N-]=[N+]=Nc1cccc2cccnc12 |
| InChI | InChI=1S/C9H6N4/c10-13-12-8-5-1-3-7-4-2-6-11-9(7)8/h1-6H |
| InChIKey | KEOFCEHKLBDSDN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 8-azidoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azidoquinoline?
The IUPAC name of 8-azidoquinoline (CID 11321201) is 8-azidoquinoline.
What is the SMILES notation for 8-azidoquinoline?
The canonical SMILES for 8-azidoquinoline is [N-]=[N+]=Nc1cccc2cccnc12.
What is the InChIKey of 8-azidoquinoline?
The InChIKey is KEOFCEHKLBDSDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4/c10-13-12-8-5-1-3-7-4-2-6-11-9(7)8/h1-6H.
What are the key properties of 8-azidoquinoline?
8-azidoquinoline has a molecular weight of 170.18 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azidoquinoline is sourced from PubChem (CID 11321201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).