C21H22FN3O5 — CID 8001798
2-[(4R)-4-[(3,4-dimethoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 8001798) has the molecular formula C21H22FN3O5 and a molecular weight of 415.42 g/mol. Its IUPAC name is 2-[(4R)-4-[(3,4-dimethoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(4R)-4-[(3,4-dimethoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 8001798 |
| Molecular Formula | C21H22FN3O5 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[(4R)-4-[(3,4-dimethoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1ccc(C[C@@]2(C)NC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H22FN3O5/c1-21(11-13-4-9-16(29-2)17(10-13)30-3)19(27)25(20(28)24-21)12-18(26)23-15-7-5-14(22)6-8-15/h4-10H,11-12H2,1-3H3,(H,23,26)(H,24,28)/t21-/m1/s1 |
| InChIKey | FQTBPVSTFUAPDV-OAQYLSRUSA-N |
| XLogP | 2.33 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|