C18H29N3O2S — CID 8003155
5-[N-(cyclohexylmethyl)-C-ethylcarbonimidoyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 8003155) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is 5-[N-(cyclohexylmethyl)-C-ethylcarbonimidoyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[N-(cyclohexylmethyl)-C-ethylcarbonimidoyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 8003155 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 5-[N-(cyclohexylmethyl)-C-ethylcarbonimidoyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC/C(=N\CC1CCCCC1)C1C(=O)N(CC)C(=S)N(CC)C1=O |
| InChI | InChI=1S/C18H29N3O2S/c1-4-14(19-12-13-10-8-7-9-11-13)15-16(22)20(5-2)18(24)21(6-3)17(15)23/h13,15H,4-12H2,1-3H3/b19-14+ |
| InChIKey | DSPQYKCRTYBLCG-XMHGGMMESA-N |
| XLogP | 3.03 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|