C16H25N3O3S — CID 8003218
5-[N-(cyclohexylmethyl)-C-methylcarbonimidoyl]-1-(2-methoxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 8003218) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 5-[N-(cyclohexylmethyl)-C-methylcarbonimidoyl]-1-(2-methoxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[N-(cyclohexylmethyl)-C-methylcarbonimidoyl]-1-(2-methoxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 8003218 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-[N-(cyclohexylmethyl)-C-methylcarbonimidoyl]-1-(2-methoxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COCCN1C(=O)C(/C(C)=N/CC2CCCCC2)C(=O)NC1=S |
| InChI | InChI=1S/C16H25N3O3S/c1-11(17-10-12-6-4-3-5-7-12)13-14(20)18-16(23)19(15(13)21)8-9-22-2/h12-13H,3-10H2,1-2H3,(H,18,20,23)/b17-11+ |
| InChIKey | CKZMSVBMPBHLLX-GZTJUZNOSA-N |
| XLogP | 1.53 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|