C17H27N3O2S — CID 8003219
5-[N-(cyclohexylmethyl)-C-methylcarbonimidoyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 8003219) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 5-[N-(cyclohexylmethyl)-C-methylcarbonimidoyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[N-(cyclohexylmethyl)-C-methylcarbonimidoyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 8003219 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 5-[N-(cyclohexylmethyl)-C-methylcarbonimidoyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(/C(C)=N/CC2CCCCC2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C17H27N3O2S/c1-4-19-15(21)14(16(22)20(5-2)17(19)23)12(3)18-11-13-9-7-6-8-10-13/h13-14H,4-11H2,1-3H3/b18-12+ |
| InChIKey | XXCMQGLGHZXWAF-LDADJPATSA-N |
| XLogP | 2.64 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|