C22H26ClN4O2+ — CID 8004058
[(3R)-1-(4-chlorobenzoyl)piperidin-3-yl]-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanone (PubChem CID 8004058) has the molecular formula C22H26ClN4O2+ and a molecular weight of 413.93 g/mol. Its IUPAC name is [(3R)-1-(4-chlorobenzoyl)piperidin-3-yl]-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanone.
| Compound Name | [(3R)-1-(4-chlorobenzoyl)piperidin-3-yl]-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 8004058 |
| Molecular Formula | C22H26ClN4O2+ |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | [(3R)-1-(4-chlorobenzoyl)piperidin-3-yl]-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCC[C@@H](C(=O)N2CCN(c3cccc[nH+]3)CC2)C1 |
| InChI | InChI=1S/C22H25ClN4O2/c23-19-8-6-17(7-9-19)21(28)27-11-3-4-18(16-27)22(29)26-14-12-25(13-15-26)20-5-1-2-10-24-20/h1-2,5-10,18H,3-4,11-16H2/p+1/t18-/m1/s1 |
| InChIKey | NKVMZFYBUKMGHC-GOSISDBHSA-O |
| XLogP | 2.36 |
| TPSA | 58.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |