C13H16N2OS2 — CID 8004897
2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-propan-2-ylacetamide (PubChem CID 8004897) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-propan-2-ylacetamide.
| Compound Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 8004897 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CSC1=Nc2ccccc2CS1 |
| InChI | InChI=1S/C13H16N2OS2/c1-9(2)14-12(16)8-18-13-15-11-6-4-3-5-10(11)7-17-13/h3-6,9H,7-8H2,1-2H3,(H,14,16) |
| InChIKey | GYMRBBJJGUHXBP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |