C15H20N2OS2 — CID 8004903
2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-[(2R)-pentan-2-yl]acetamide (PubChem CID 8004903) has the molecular formula C15H20N2OS2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-[(2R)-pentan-2-yl]acetamide.
| Compound Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-[(2R)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 8004903 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-[(2R)-pentan-2-yl]acetamide |
| SMILES | CCC[C@@H](C)NC(=O)CSC1=Nc2ccccc2CS1 |
| InChI | InChI=1S/C15H20N2OS2/c1-3-6-11(2)16-14(18)10-20-15-17-13-8-5-4-7-12(13)9-19-15/h4-5,7-8,11H,3,6,9-10H2,1-2H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | IHYWZONNHARLGR-LLVKDONJSA-N |
| XLogP | 3.96 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |