C19H23N4O3+ — CID 8006194
methyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]azanium (PubChem CID 8006194) has the molecular formula C19H23N4O3+ and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]azanium.
| Compound Name | methyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8006194 |
| Molecular Formula | C19H23N4O3+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | methyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]azanium |
| SMILES | C=CCNC(=O)NC(=O)C[NH+](C)CC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H22N4O3/c1-3-11-20-19(26)22-18(25)13-23(2)12-17(24)21-16-10-6-8-14-7-4-5-9-15(14)16/h3-10H,1,11-13H2,2H3,(H,21,24)(H2,20,22,25,26)/p+1 |
| InChIKey | JVPIJSJLNULIQZ-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|