C18H18F2N2O3 — CID 8006852
(3R)-3-(3,4-difluoroanilino)-4-(2,6-dimethylanilino)-4-oxobutanoic acid (PubChem CID 8006852) has the molecular formula C18H18F2N2O3 and a molecular weight of 348.35 g/mol. Its IUPAC name is (3R)-3-(3,4-difluoroanilino)-4-(2,6-dimethylanilino)-4-oxobutanoic acid.
| Compound Name | (3R)-3-(3,4-difluoroanilino)-4-(2,6-dimethylanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 8006852 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (3R)-3-(3,4-difluoroanilino)-4-(2,6-dimethylanilino)-4-oxobutanoic acid |
| SMILES | Cc1cccc(C)c1NC(=O)[C@@H](CC(=O)O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H18F2N2O3/c1-10-4-3-5-11(2)17(10)22-18(25)15(9-16(23)24)21-12-6-7-13(19)14(20)8-12/h3-8,15,21H,9H2,1-2H3,(H,22,25)(H,23,24)/t15-/m1/s1 |
| InChIKey | HLQJCAPYXSJCPK-OAHLLOKOSA-N |
| XLogP | 3.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |