C22H27N2O5+ — CID 8008677
(2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanamide (PubChem CID 8008677) has the molecular formula C22H27N2O5+ and a molecular weight of 399.47 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanamide.
| Compound Name | (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
|---|---|
| PubChem CID | 8008677 |
| Molecular Formula | C22H27N2O5+ |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
| SMILES | COc1cc2c(cc1OC)C[NH+]([C@@H](C)C(=O)Nc1ccc3c(c1)OCCO3)CC2 |
| InChI | InChI=1S/C22H26N2O5/c1-14(22(25)23-17-4-5-18-21(12-17)29-9-8-28-18)24-7-6-15-10-19(26-2)20(27-3)11-16(15)13-24/h4-5,10-12,14H,6-9,13H2,1-3H3,(H,23,25)/p+1/t14-/m0/s1 |
| InChIKey | YKFLDIOJPOCMJL-AWEZNQCLSA-O |
| XLogP | 1.44 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |