C14H14N4O3S — CID 8014753
N-[2-(cyanomethylsulfanyl)phenyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 8014753) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8014753 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)Nc2ccccc2SCC#N)C1=O |
| InChI | InChI=1S/C14H14N4O3S/c1-17-9-13(20)18(14(17)21)8-12(19)16-10-4-2-3-5-11(10)22-7-6-15/h2-5H,7-9H2,1H3,(H,16,19) |
| InChIKey | DZJFONQJLAPMRY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|