C20H19N3O2 — CID 8016312
2-[(4R)-5-oxo-2,3,4,6-tetrahydro-1H-azepino[4,5-b]indol-4-yl]-N-phenylacetamide (PubChem CID 8016312) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[(4R)-5-oxo-2,3,4,6-tetrahydro-1H-azepino[4,5-b]indol-4-yl]-N-phenylacetamide.
| Compound Name | 2-[(4R)-5-oxo-2,3,4,6-tetrahydro-1H-azepino[4,5-b]indol-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 8016312 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-[(4R)-5-oxo-2,3,4,6-tetrahydro-1H-azepino[4,5-b]indol-4-yl]-N-phenylacetamide |
| SMILES | O=C(C[C@H]1NCCc2c([nH]c3ccccc23)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c24-18(22-13-6-2-1-3-7-13)12-17-20(25)19-15(10-11-21-17)14-8-4-5-9-16(14)23-19/h1-9,17,21,23H,10-12H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | XFJQLPHHGKAXEN-QGZVFWFLSA-N |
| XLogP | 2.89 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|