C18H24N3O4+ — CID 8024025
(4-ethoxyphenyl)methyl-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]-methylazanium (PubChem CID 8024025) has the molecular formula C18H24N3O4+ and a molecular weight of 346.41 g/mol. Its IUPAC name is (4-ethoxyphenyl)methyl-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]-methylazanium.
| Compound Name | (4-ethoxyphenyl)methyl-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8024025 |
| Molecular Formula | C18H24N3O4+ |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (4-ethoxyphenyl)methyl-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]-methylazanium |
| SMILES | CCOc1ccc(C[NH+](C)CC(=O)NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C18H23N3O4/c1-3-24-15-8-6-14(7-9-15)12-21(2)13-17(22)20-18(23)19-11-16-5-4-10-25-16/h4-10H,3,11-13H2,1-2H3,(H2,19,20,22,23)/p+1 |
| InChIKey | CFSFAHWVPMMACH-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |