C7H14N2S — CID 80500566
7,7-dimethyl-5-thia-2,8-diazaspiro[3.4]octane (PubChem CID 80500566) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is 7,7-dimethyl-5-thia-2,8-diazaspiro[3.4]octane.
| Compound Name | 7,7-dimethyl-5-thia-2,8-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 80500566 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 7,7-dimethyl-5-thia-2,8-diazaspiro[3.4]octane |
| SMILES | CC1(C)CSC2(CNC2)N1 |
| InChI | InChI=1S/C7H14N2S/c1-6(2)5-10-7(9-6)3-8-4-7/h8-9H,3-5H2,1-2H3 |
| InChIKey | SXLYQHLNQXKVFL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |