C14H13F3N2O2 — CID 80500942
1-cyano-3-methyl-N-[4-(trifluoromethoxy)phenyl]cyclobutane-1-carboxamide (PubChem CID 80500942) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is 1-cyano-3-methyl-N-[4-(trifluoromethoxy)phenyl]cyclobutane-1-carboxamide.
| Compound Name | 1-cyano-3-methyl-N-[4-(trifluoromethoxy)phenyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80500942 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-cyano-3-methyl-N-[4-(trifluoromethoxy)phenyl]cyclobutane-1-carboxamide |
| SMILES | CC1CC(C#N)(C(=O)Nc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H13F3N2O2/c1-9-6-13(7-9,8-18)12(20)19-10-2-4-11(5-3-10)21-14(15,16)17/h2-5,9H,6-7H2,1H3,(H,19,20) |
| InChIKey | XWMVOOIMAUXFDA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |