C13H18ClN3S — CID 80514725
3-(3-chloro-2-methylpropyl)sulfanyl-5,6-diethylpyridazine-4-carbonitrile (PubChem CID 80514725) has the molecular formula C13H18ClN3S and a molecular weight of 283.83 g/mol. Its IUPAC name is 3-(3-chloro-2-methylpropyl)sulfanyl-5,6-diethylpyridazine-4-carbonitrile.
| Compound Name | 3-(3-chloro-2-methylpropyl)sulfanyl-5,6-diethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80514725 |
| Molecular Formula | C13H18ClN3S |
| Molecular Weight | 283.83 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-(3-chloro-2-methylpropyl)sulfanyl-5,6-diethylpyridazine-4-carbonitrile |
| SMILES | CCc1nnc(SCC(C)CCl)c(C#N)c1CC |
| InChI | InChI=1S/C13H18ClN3S/c1-4-10-11(7-15)13(17-16-12(10)5-2)18-8-9(3)6-14/h9H,4-6,8H2,1-3H3 |
| InChIKey | VRIDPLOORLUODH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.83 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|