C13H19N3OS — CID 84586929
3-(2-ethoxyethylsulfanyl)-5,6-diethylpyridazine-4-carbonitrile (PubChem CID 84586929) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-(2-ethoxyethylsulfanyl)-5,6-diethylpyridazine-4-carbonitrile.
| Compound Name | 3-(2-ethoxyethylsulfanyl)-5,6-diethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 84586929 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-(2-ethoxyethylsulfanyl)-5,6-diethylpyridazine-4-carbonitrile |
| SMILES | CCOCCSc1nnc(CC)c(CC)c1C#N |
| InChI | InChI=1S/C13H19N3OS/c1-4-10-11(9-14)13(16-15-12(10)5-2)18-8-7-17-6-3/h4-8H2,1-3H3 |
| InChIKey | SRZDCYZCLYBHGK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|