C12H18N4S — CID 80509565
5,6-diethyl-3-(2-methylsulfanylethylamino)pyridazine-4-carbonitrile (PubChem CID 80509565) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 5,6-diethyl-3-(2-methylsulfanylethylamino)pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-(2-methylsulfanylethylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80509565 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 5,6-diethyl-3-(2-methylsulfanylethylamino)pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(NCCSC)c(C#N)c1CC |
| InChI | InChI=1S/C12H18N4S/c1-4-9-10(8-13)12(14-6-7-17-3)16-15-11(9)5-2/h4-7H2,1-3H3,(H,14,16) |
| InChIKey | IDOJNUNFSHAGCO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|