C12H14N4 — CID 80509398
5,6-diethyl-3-(prop-2-ynylamino)pyridazine-4-carbonitrile (PubChem CID 80509398) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 5,6-diethyl-3-(prop-2-ynylamino)pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-(prop-2-ynylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80509398 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 5,6-diethyl-3-(prop-2-ynylamino)pyridazine-4-carbonitrile |
| SMILES | C#CCNc1nnc(CC)c(CC)c1C#N |
| InChI | InChI=1S/C12H14N4/c1-4-7-14-12-10(8-13)9(5-2)11(6-3)15-16-12/h1H,5-7H2,2-3H3,(H,14,16) |
| InChIKey | UURHWWDANISSGY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|