C16H26N4 — CID 115325591
5,6-diethyl-3-(5-methylhexylamino)pyridazine-4-carbonitrile (PubChem CID 115325591) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 5,6-diethyl-3-(5-methylhexylamino)pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-(5-methylhexylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 115325591 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 5,6-diethyl-3-(5-methylhexylamino)pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(NCCCCC(C)C)c(C#N)c1CC |
| InChI | InChI=1S/C16H26N4/c1-5-13-14(11-17)16(20-19-15(13)6-2)18-10-8-7-9-12(3)4/h12H,5-10H2,1-4H3,(H,18,20) |
| InChIKey | PCJZVOKQALGFAX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|