C13H18N4O2 — CID 80508019
4-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]butanoic acid (PubChem CID 80508019) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]butanoic acid.
| Compound Name | 4-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 80508019 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]butanoic acid |
| SMILES | CCc1nnc(NCCCC(=O)O)c(C#N)c1CC |
| InChI | InChI=1S/C13H18N4O2/c1-3-9-10(8-14)13(17-16-11(9)4-2)15-7-5-6-12(18)19/h3-7H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | NQCYVQRPGPRBDU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|