C16H25N5O2 — CID 103756562
tert-butyl N-[2-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]ethyl]carbamate (PubChem CID 103756562) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 103756562 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl N-[2-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]ethyl]carbamate |
| SMILES | CCc1nnc(NCCNC(=O)OC(C)(C)C)c(C#N)c1CC |
| InChI | InChI=1S/C16H25N5O2/c1-6-11-12(10-17)14(21-20-13(11)7-2)18-8-9-19-15(22)23-16(3,4)5/h6-9H2,1-5H3,(H,18,21)(H,19,22) |
| InChIKey | OTPZTAGLPHMIMR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|