C14H24N6O2 — CID 102795954
tert-butyl N-[2-[(5-amino-4-cyano-1-propan-2-ylpyrazol-3-yl)amino]ethyl]carbamate (PubChem CID 102795954) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-amino-4-cyano-1-propan-2-ylpyrazol-3-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-amino-4-cyano-1-propan-2-ylpyrazol-3-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 102795954 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | tert-butyl N-[2-[(5-amino-4-cyano-1-propan-2-ylpyrazol-3-yl)amino]ethyl]carbamate |
| SMILES | CC(C)n1nc(NCCNC(=O)OC(C)(C)C)c(C#N)c1N |
| InChI | InChI=1S/C14H24N6O2/c1-9(2)20-11(16)10(8-15)12(19-20)17-6-7-18-13(21)22-14(3,4)5/h9H,6-7,16H2,1-5H3,(H,17,19)(H,18,21) |
| InChIKey | DTJSOZOMJSXFLK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|