C19H25N5 — CID 133360889
3-[2-[4-(dimethylamino)phenyl]ethylamino]-5,6-diethylpyridazine-4-carbonitrile (PubChem CID 133360889) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[2-[4-(dimethylamino)phenyl]ethylamino]-5,6-diethylpyridazine-4-carbonitrile.
| Compound Name | 3-[2-[4-(dimethylamino)phenyl]ethylamino]-5,6-diethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 133360889 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 3-[2-[4-(dimethylamino)phenyl]ethylamino]-5,6-diethylpyridazine-4-carbonitrile |
| SMILES | CCc1nnc(NCCc2ccc(N(C)C)cc2)c(C#N)c1CC |
| InChI | InChI=1S/C19H25N5/c1-5-16-17(13-20)19(23-22-18(16)6-2)21-12-11-14-7-9-15(10-8-14)24(3)4/h7-10H,5-6,11-12H2,1-4H3,(H,21,23) |
| InChIKey | CNEHBMVSJZOMNW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|