C12H18N6O — CID 80527134
2-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]ethylurea (PubChem CID 80527134) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]ethylurea.
| Compound Name | 2-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]ethylurea |
|---|---|
| PubChem CID | 80527134 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]ethylurea |
| SMILES | CCc1nnc(NCCNC(N)=O)c(C#N)c1CC |
| InChI | InChI=1S/C12H18N6O/c1-3-8-9(7-13)11(18-17-10(8)4-2)15-5-6-16-12(14)19/h3-6H2,1-2H3,(H,15,18)(H3,14,16,19) |
| InChIKey | TVEBEBVXLZKOAN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|