C18H29N5 — CID 133374001
5,6-diethyl-3-[3-(3-methylpiperidin-1-yl)propylamino]pyridazine-4-carbonitrile (PubChem CID 133374001) has the molecular formula C18H29N5 and a molecular weight of 315.47 g/mol. Its IUPAC name is 5,6-diethyl-3-[3-(3-methylpiperidin-1-yl)propylamino]pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-[3-(3-methylpiperidin-1-yl)propylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 133374001 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 5,6-diethyl-3-[3-(3-methylpiperidin-1-yl)propylamino]pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(NCCCN2CCCC(C)C2)c(C#N)c1CC |
| InChI | InChI=1S/C18H29N5/c1-4-15-16(12-19)18(22-21-17(15)5-2)20-9-7-11-23-10-6-8-14(3)13-23/h14H,4-11,13H2,1-3H3,(H,20,22) |
| InChIKey | RJQBFIKJEPGWGU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|