C13H14FNO5S — CID 80517167
2-[4-(4-fluorobenzoyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (PubChem CID 80517167) has the molecular formula C13H14FNO5S and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[4-(4-fluorobenzoyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
| Compound Name | 2-[4-(4-fluorobenzoyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
|---|---|
| PubChem CID | 80517167 |
| Molecular Formula | C13H14FNO5S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[4-(4-fluorobenzoyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CS(=O)(=O)CCN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H14FNO5S/c14-10-3-1-9(2-4-10)13(18)15-5-6-21(19,20)8-11(15)7-12(16)17/h1-4,11H,5-8H2,(H,16,17) |
| InChIKey | RRBWOVYWLWRLDC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |