C9H10F3N5O — CID 80527567
6-(4,4,4-trifluorobutylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 80527567) has the molecular formula C9H10F3N5O and a molecular weight of 261.21 g/mol. Its IUPAC name is 6-(4,4,4-trifluorobutylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(4,4,4-trifluorobutylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 80527567 |
| Molecular Formula | C9H10F3N5O |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 6-(4,4,4-trifluorobutylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(NCCCC(F)(F)F)nn12 |
| InChI | InChI=1S/C9H10F3N5O/c10-9(11,12)4-1-5-13-6-2-3-7-14-15-8(18)17(7)16-6/h2-3H,1,4-5H2,(H,13,16)(H,15,18) |
| InChIKey | DOBFLRGRVADVTJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|