C12H7Br2IO2S — CID 80536150
(4,5-dibromothiophen-2-yl)-(5-iodo-2-methoxyphenyl)methanone (PubChem CID 80536150) has the molecular formula C12H7Br2IO2S and a molecular weight of 501.97 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(5-iodo-2-methoxyphenyl)methanone.
| Compound Name | (4,5-dibromothiophen-2-yl)-(5-iodo-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 80536150 |
| Molecular Formula | C12H7Br2IO2S |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 499.76 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(5-iodo-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(I)cc1C(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H7Br2IO2S/c1-17-9-3-2-6(15)4-7(9)11(16)10-5-8(13)12(14)18-10/h2-5H,1H3 |
| InChIKey | CEQIMCRGODUGCB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|