C15H13IO2S2 — CID 81270140
6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(5-iodo-2-methoxyphenyl)methanone (PubChem CID 81270140) has the molecular formula C15H13IO2S2 and a molecular weight of 416.31 g/mol. Its IUPAC name is 6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(5-iodo-2-methoxyphenyl)methanone.
| Compound Name | 6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(5-iodo-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 81270140 |
| Molecular Formula | C15H13IO2S2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(5-iodo-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(I)cc1C(=O)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C15H13IO2S2/c1-18-12-3-2-10(16)7-11(12)15(17)14-6-9-8-19-5-4-13(9)20-14/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | NPXHTDDLVSHCJC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|