C14H13IO2S — CID 65237438
(4,5-dimethylthiophen-2-yl)-(5-iodo-2-methoxyphenyl)methanone (PubChem CID 65237438) has the molecular formula C14H13IO2S and a molecular weight of 372.23 g/mol. Its IUPAC name is (4,5-dimethylthiophen-2-yl)-(5-iodo-2-methoxyphenyl)methanone.
| Compound Name | (4,5-dimethylthiophen-2-yl)-(5-iodo-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 65237438 |
| Molecular Formula | C14H13IO2S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | (4,5-dimethylthiophen-2-yl)-(5-iodo-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(I)cc1C(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C14H13IO2S/c1-8-6-13(18-9(8)2)14(16)11-7-10(15)4-5-12(11)17-3/h4-7H,1-3H3 |
| InChIKey | RUVCJHAYVWCIGK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|