C13H10Br2N2OS — CID 80537259
(4-amino-2,3-dihydroindol-1-yl)-(4,5-dibromothiophen-2-yl)methanone (PubChem CID 80537259) has the molecular formula C13H10Br2N2OS and a molecular weight of 402.11 g/mol. Its IUPAC name is (4-amino-2,3-dihydroindol-1-yl)-(4,5-dibromothiophen-2-yl)methanone.
| Compound Name | (4-amino-2,3-dihydroindol-1-yl)-(4,5-dibromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 80537259 |
| Molecular Formula | C13H10Br2N2OS |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | (4-amino-2,3-dihydroindol-1-yl)-(4,5-dibromothiophen-2-yl)methanone |
| SMILES | Nc1cccc2c1CCN2C(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H10Br2N2OS/c14-8-6-11(19-12(8)15)13(18)17-5-4-7-9(16)2-1-3-10(7)17/h1-3,6H,4-5,16H2 |
| InChIKey | ZPBTWZUCEDSMDW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|