C11H8Br2ClNS — CID 80538308
4-[2-chloro-2-(4,5-dibromothiophen-2-yl)ethyl]pyridine (PubChem CID 80538308) has the molecular formula C11H8Br2ClNS and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[2-chloro-2-(4,5-dibromothiophen-2-yl)ethyl]pyridine.
| Compound Name | 4-[2-chloro-2-(4,5-dibromothiophen-2-yl)ethyl]pyridine |
|---|---|
| PubChem CID | 80538308 |
| Molecular Formula | C11H8Br2ClNS |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 378.84 |
| IUPAC Name | 4-[2-chloro-2-(4,5-dibromothiophen-2-yl)ethyl]pyridine |
| SMILES | ClC(Cc1ccncc1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H8Br2ClNS/c12-8-6-10(16-11(8)13)9(14)5-7-1-3-15-4-2-7/h1-4,6,9H,5H2 |
| InChIKey | FGKPRIHQZJVXBI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|