C15H28N2O3 — CID 80543187
4-amino-2-methyl-N,N-bis(oxolan-2-ylmethyl)butanamide (PubChem CID 80543187) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-amino-2-methyl-N,N-bis(oxolan-2-ylmethyl)butanamide.
| Compound Name | 4-amino-2-methyl-N,N-bis(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 80543187 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 4-amino-2-methyl-N,N-bis(oxolan-2-ylmethyl)butanamide |
| SMILES | CC(CCN)C(=O)N(CC1CCCO1)CC1CCCO1 |
| InChI | InChI=1S/C15H28N2O3/c1-12(6-7-16)15(18)17(10-13-4-2-8-19-13)11-14-5-3-9-20-14/h12-14H,2-11,16H2,1H3 |
| InChIKey | OJFYFSLIZKAZHY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |