C14H26N2O3 — CID 54873321
4-amino-N,N-bis(oxolan-2-ylmethyl)butanamide (PubChem CID 54873321) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-amino-N,N-bis(oxolan-2-ylmethyl)butanamide.
| Compound Name | 4-amino-N,N-bis(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 54873321 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-amino-N,N-bis(oxolan-2-ylmethyl)butanamide |
| SMILES | NCCCC(=O)N(CC1CCCO1)CC1CCCO1 |
| InChI | InChI=1S/C14H26N2O3/c15-7-1-6-14(17)16(10-12-4-2-8-18-12)11-13-5-3-9-19-13/h12-13H,1-11,15H2 |
| InChIKey | BTSQKXKAXIYTHG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |