C16H30N2O3 — CID 82850780
5-amino-N,N-bis(oxolan-2-ylmethyl)hexanamide (PubChem CID 82850780) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is 5-amino-N,N-bis(oxolan-2-ylmethyl)hexanamide.
| Compound Name | 5-amino-N,N-bis(oxolan-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 82850780 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 5-amino-N,N-bis(oxolan-2-ylmethyl)hexanamide |
| SMILES | CC(N)CCCC(=O)N(CC1CCCO1)CC1CCCO1 |
| InChI | InChI=1S/C16H30N2O3/c1-13(17)5-2-8-16(19)18(11-14-6-3-9-20-14)12-15-7-4-10-21-15/h13-15H,2-12,17H2,1H3 |
| InChIKey | HIOMDUFYCHTQJK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |